C29H19F5O — CID 139857668
6-[2-[2,6-difluoro-4-[2-(2-fluoro-4-prop-2-enoxyphenyl)ethyl]phenyl]ethynyl]-2,3-difluoronaphthalene (PubChem CID 139857668) has the molecular formula C29H19F5O and a molecular weight of 478.46 g/mol. Its IUPAC name is 6-[2-[2,6-difluoro-4-[2-(2-fluoro-4-prop-2-enoxyphenyl)ethyl]phenyl]ethynyl]-2,3-difluoronaphthalene.
| Compound Name | 6-[2-[2,6-difluoro-4-[2-(2-fluoro-4-prop-2-enoxyphenyl)ethyl]phenyl]ethynyl]-2,3-difluoronaphthalene |
|---|---|
| PubChem CID | 139857668 |
| Molecular Formula | C29H19F5O |
| Molecular Weight | 478.46 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 6-[2-[2,6-difluoro-4-[2-(2-fluoro-4-prop-2-enoxyphenyl)ethyl]phenyl]ethynyl]-2,3-difluoronaphthalene |
| SMILES | C=CCOc1ccc(CCc2cc(F)c(C#Cc3ccc4cc(F)c(F)cc4c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C29H19F5O/c1-2-11-35-23-9-8-20(25(30)17-23)6-4-19-13-26(31)24(27(32)14-19)10-5-18-3-7-21-15-28(33)29(34)16-22(21)12-18/h2-3,7-9,12-17H,1,4,6,11H2 |
| InChIKey | VWKFCFNMKSVDES-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.46 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|