C21H17F3O2 — CID 139863205
2-[1,2-difluoro-2-(4-methoxyphenyl)ethenyl]-6-ethoxy-1-fluoronaphthalene (PubChem CID 139863205) has the molecular formula C21H17F3O2 and a molecular weight of 358.36 g/mol. Its IUPAC name is 2-[1,2-difluoro-2-(4-methoxyphenyl)ethenyl]-6-ethoxy-1-fluoronaphthalene.
| Compound Name | 2-[1,2-difluoro-2-(4-methoxyphenyl)ethenyl]-6-ethoxy-1-fluoronaphthalene |
|---|---|
| PubChem CID | 139863205 |
| Molecular Formula | C21H17F3O2 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 2-[1,2-difluoro-2-(4-methoxyphenyl)ethenyl]-6-ethoxy-1-fluoronaphthalene |
| SMILES | CCOc1ccc2c(F)c(C(F)=C(F)c3ccc(OC)cc3)ccc2c1 |
| InChI | InChI=1S/C21H17F3O2/c1-3-26-16-9-11-17-14(12-16)6-10-18(20(17)23)21(24)19(22)13-4-7-15(25-2)8-5-13/h4-12H,3H2,1-2H3 |
| InChIKey | QLZHRFGAQLEDPW-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|