C20H13F7O2 — CID 139856090
6-[(4-ethoxy-2-fluorophenyl)-difluoromethoxy]-1-fluoro-2-(trifluoromethyl)naphthalene (PubChem CID 139856090) has the molecular formula C20H13F7O2 and a molecular weight of 418.31 g/mol. Its IUPAC name is 6-[(4-ethoxy-2-fluorophenyl)-difluoromethoxy]-1-fluoro-2-(trifluoromethyl)naphthalene.
| Compound Name | 6-[(4-ethoxy-2-fluorophenyl)-difluoromethoxy]-1-fluoro-2-(trifluoromethyl)naphthalene |
|---|---|
| PubChem CID | 139856090 |
| Molecular Formula | C20H13F7O2 |
| Molecular Weight | 418.31 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 6-[(4-ethoxy-2-fluorophenyl)-difluoromethoxy]-1-fluoro-2-(trifluoromethyl)naphthalene |
| SMILES | CCOc1ccc(C(F)(F)Oc2ccc3c(F)c(C(F)(F)F)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C20H13F7O2/c1-2-28-12-5-8-15(17(21)10-12)20(26,27)29-13-4-6-14-11(9-13)3-7-16(18(14)22)19(23,24)25/h3-10H,2H2,1H3 |
| InChIKey | BXTUDZXRIHPMNH-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.31 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |