C24H19F5O — CID 139862957
3-[2-(4-but-3-enylphenyl)-1,2-difluoroethenyl]-7-ethoxy-1,2,8-trifluoronaphthalene (PubChem CID 139862957) has the molecular formula C24H19F5O and a molecular weight of 418.41 g/mol. Its IUPAC name is 3-[2-(4-but-3-enylphenyl)-1,2-difluoroethenyl]-7-ethoxy-1,2,8-trifluoronaphthalene.
| Compound Name | 3-[2-(4-but-3-enylphenyl)-1,2-difluoroethenyl]-7-ethoxy-1,2,8-trifluoronaphthalene |
|---|---|
| PubChem CID | 139862957 |
| Molecular Formula | C24H19F5O |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 3-[2-(4-but-3-enylphenyl)-1,2-difluoroethenyl]-7-ethoxy-1,2,8-trifluoronaphthalene |
| SMILES | C=CCCc1ccc(C(F)=C(F)c2cc3ccc(OCC)c(F)c3c(F)c2F)cc1 |
| InChI | InChI=1S/C24H19F5O/c1-3-5-6-14-7-9-15(10-8-14)20(25)21(26)17-13-16-11-12-18(30-4-2)23(28)19(16)24(29)22(17)27/h3,7-13H,1,4-6H2,2H3 |
| InChIKey | RVXHDRGFARXSES-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|