C23H19F3O — CID 139862919
6-[2-(4-ethylphenyl)-1,2-difluoroethenyl]-1-fluoro-2-prop-2-enoxynaphthalene (PubChem CID 139862919) has the molecular formula C23H19F3O and a molecular weight of 368.40 g/mol. Its IUPAC name is 6-[2-(4-ethylphenyl)-1,2-difluoroethenyl]-1-fluoro-2-prop-2-enoxynaphthalene.
| Compound Name | 6-[2-(4-ethylphenyl)-1,2-difluoroethenyl]-1-fluoro-2-prop-2-enoxynaphthalene |
|---|---|
| PubChem CID | 139862919 |
| Molecular Formula | C23H19F3O |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 6-[2-(4-ethylphenyl)-1,2-difluoroethenyl]-1-fluoro-2-prop-2-enoxynaphthalene |
| SMILES | C=CCOc1ccc2cc(C(F)=C(F)c3ccc(CC)cc3)ccc2c1F |
| InChI | InChI=1S/C23H19F3O/c1-3-13-27-20-12-10-17-14-18(9-11-19(17)23(20)26)22(25)21(24)16-7-5-15(4-2)6-8-16/h3,5-12,14H,1,4,13H2,2H3 |
| InChIKey | HRLBFYXMRMQNHN-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|