C29H35F3O3 — CID 134190990
7-butoxy-3-[(E)-1,2-difluoro-2-[4-[(3E)-octa-3,7-dienyl]cyclohexyl]ethenyl]-8-fluoroisochromen-1-one (PubChem CID 134190990) has the molecular formula C29H35F3O3 and a molecular weight of 488.59 g/mol. Its IUPAC name is 7-butoxy-3-[(E)-1,2-difluoro-2-[4-[(3E)-octa-3,7-dienyl]cyclohexyl]ethenyl]-8-fluoroisochromen-1-one.
| Compound Name | 7-butoxy-3-[(E)-1,2-difluoro-2-[4-[(3E)-octa-3,7-dienyl]cyclohexyl]ethenyl]-8-fluoroisochromen-1-one |
|---|---|
| PubChem CID | 134190990 |
| Molecular Formula | C29H35F3O3 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | 7-butoxy-3-[(E)-1,2-difluoro-2-[4-[(3E)-octa-3,7-dienyl]cyclohexyl]ethenyl]-8-fluoroisochromen-1-one |
| SMILES | C=CCC/C=C/CCC1CCC(/C(F)=C(\F)c2cc3ccc(OCCCC)c(F)c3c(=O)o2)CC1 |
| InChI | InChI=1S/C29H35F3O3/c1-3-5-7-8-9-10-11-20-12-14-21(15-13-20)26(30)28(32)24-19-22-16-17-23(34-18-6-4-2)27(31)25(22)29(33)35-24/h3,8-9,16-17,19-21H,1,4-7,10-15,18H2,2H3/b9-8+,28-26+ |
| InChIKey | SYIHYYHYVOFJFK-WBJILXIBSA-N |
| XLogP | 8.83 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|