C27H35FO3 — CID 134190699
7-butoxy-8-fluoro-3-[4-[(3E)-octa-3,7-dienyl]cyclohexyl]isochromen-1-one (PubChem CID 134190699) has the molecular formula C27H35FO3 and a molecular weight of 426.57 g/mol. Its IUPAC name is 7-butoxy-8-fluoro-3-[4-[(3E)-octa-3,7-dienyl]cyclohexyl]isochromen-1-one.
| Compound Name | 7-butoxy-8-fluoro-3-[4-[(3E)-octa-3,7-dienyl]cyclohexyl]isochromen-1-one |
|---|---|
| PubChem CID | 134190699 |
| Molecular Formula | C27H35FO3 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | 7-butoxy-8-fluoro-3-[4-[(3E)-octa-3,7-dienyl]cyclohexyl]isochromen-1-one |
| SMILES | C=CCC/C=C/CCC1CCC(c2cc3ccc(OCCCC)c(F)c3c(=O)o2)CC1 |
| InChI | InChI=1S/C27H35FO3/c1-3-5-7-8-9-10-11-20-12-14-21(15-13-20)24-19-22-16-17-23(30-18-6-4-2)26(28)25(22)27(29)31-24/h3,8-9,16-17,19-21H,1,4-7,10-15,18H2,2H3/b9-8+ |
| InChIKey | QGPDZDSKDFVHNL-CMDGGOBGSA-N |
| XLogP | 7.69 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|