C35H36F2O3 — CID 134191224
3-[4-(4-but-3-enyl-3-fluorophenyl)cyclohexyl]-8-fluoro-7-[(4-propylphenyl)methoxy]isochromen-1-one (PubChem CID 134191224) has the molecular formula C35H36F2O3 and a molecular weight of 542.67 g/mol. Its IUPAC name is 3-[4-(4-but-3-enyl-3-fluorophenyl)cyclohexyl]-8-fluoro-7-[(4-propylphenyl)methoxy]isochromen-1-one.
| Compound Name | 3-[4-(4-but-3-enyl-3-fluorophenyl)cyclohexyl]-8-fluoro-7-[(4-propylphenyl)methoxy]isochromen-1-one |
|---|---|
| PubChem CID | 134191224 |
| Molecular Formula | C35H36F2O3 |
| Molecular Weight | 542.67 g/mol |
| Exact Mass | 542.26 |
| IUPAC Name | 3-[4-(4-but-3-enyl-3-fluorophenyl)cyclohexyl]-8-fluoro-7-[(4-propylphenyl)methoxy]isochromen-1-one |
| SMILES | C=CCCc1ccc(C2CCC(c3cc4ccc(OCc5ccc(CCC)cc5)c(F)c4c(=O)o3)CC2)cc1F |
| InChI | InChI=1S/C35H36F2O3/c1-3-5-7-26-14-17-28(20-30(26)36)25-12-15-27(16-13-25)32-21-29-18-19-31(34(37)33(29)35(38)40-32)39-22-24-10-8-23(6-4-2)9-11-24/h3,8-11,14,17-21,25,27H,1,4-7,12-13,15-16,22H2,2H3 |
| InChIKey | XADHKULNXGMOAW-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.67 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|