C25H31FO3 — CID 134190713
7-ethoxy-8-fluoro-3-[4-[(3E)-octa-3,7-dienyl]cyclohexyl]isochromen-1-one (PubChem CID 134190713) has the molecular formula C25H31FO3 and a molecular weight of 398.52 g/mol. Its IUPAC name is 7-ethoxy-8-fluoro-3-[4-[(3E)-octa-3,7-dienyl]cyclohexyl]isochromen-1-one.
| Compound Name | 7-ethoxy-8-fluoro-3-[4-[(3E)-octa-3,7-dienyl]cyclohexyl]isochromen-1-one |
|---|---|
| PubChem CID | 134190713 |
| Molecular Formula | C25H31FO3 |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | 7-ethoxy-8-fluoro-3-[4-[(3E)-octa-3,7-dienyl]cyclohexyl]isochromen-1-one |
| SMILES | C=CCC/C=C/CCC1CCC(c2cc3ccc(OCC)c(F)c3c(=O)o2)CC1 |
| InChI | InChI=1S/C25H31FO3/c1-3-5-6-7-8-9-10-18-11-13-19(14-12-18)22-17-20-15-16-21(28-4-2)24(26)23(20)25(27)29-22/h3,7-8,15-19H,1,4-6,9-14H2,2H3/b8-7+ |
| InChIKey | VZDBOXUXIFQBSO-BQYQJAHWSA-N |
| XLogP | 6.91 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|