C34H47FO2 — CID 134191186
3-[4-(4-ethenylcyclohexyl)cyclohexyl]-8-fluoro-7-(4-pentylcyclohexyl)isochromen-1-one (PubChem CID 134191186) has the molecular formula C34H47FO2 and a molecular weight of 506.75 g/mol. Its IUPAC name is 3-[4-(4-ethenylcyclohexyl)cyclohexyl]-8-fluoro-7-(4-pentylcyclohexyl)isochromen-1-one.
| Compound Name | 3-[4-(4-ethenylcyclohexyl)cyclohexyl]-8-fluoro-7-(4-pentylcyclohexyl)isochromen-1-one |
|---|---|
| PubChem CID | 134191186 |
| Molecular Formula | C34H47FO2 |
| Molecular Weight | 506.75 g/mol |
| Exact Mass | 506.36 |
| IUPAC Name | 3-[4-(4-ethenylcyclohexyl)cyclohexyl]-8-fluoro-7-(4-pentylcyclohexyl)isochromen-1-one |
| SMILES | C=CC1CCC(C2CCC(c3cc4ccc(C5CCC(CCCCC)CC5)c(F)c4c(=O)o3)CC2)CC1 |
| InChI | InChI=1S/C34H47FO2/c1-3-5-6-7-24-10-14-27(15-11-24)30-21-20-29-22-31(37-34(36)32(29)33(30)35)28-18-16-26(17-19-28)25-12-8-23(4-2)9-13-25/h4,20-28H,2-3,5-19H2,1H3 |
| InChIKey | QLCBXORFNWTKPV-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.75 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|