C25H29F5 — CID 139863655
7-[2-(4-ethylcyclohexyl)-1,2-difluoroethenyl]-1,2,8-trifluoro-3-pentylnaphthalene (PubChem CID 139863655) has the molecular formula C25H29F5 and a molecular weight of 424.50 g/mol. Its IUPAC name is 7-[2-(4-ethylcyclohexyl)-1,2-difluoroethenyl]-1,2,8-trifluoro-3-pentylnaphthalene.
| Compound Name | 7-[2-(4-ethylcyclohexyl)-1,2-difluoroethenyl]-1,2,8-trifluoro-3-pentylnaphthalene |
|---|---|
| PubChem CID | 139863655 |
| Molecular Formula | C25H29F5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 7-[2-(4-ethylcyclohexyl)-1,2-difluoroethenyl]-1,2,8-trifluoro-3-pentylnaphthalene |
| SMILES | CCCCCc1cc2ccc(C(F)=C(F)C3CCC(CC)CC3)c(F)c2c(F)c1F |
| InChI | InChI=1S/C25H29F5/c1-3-5-6-7-18-14-17-12-13-19(23(28)20(17)25(30)22(18)27)24(29)21(26)16-10-8-15(4-2)9-11-16/h12-16H,3-11H2,1-2H3 |
| InChIKey | RJSZVFMZRXVICB-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|