C25H26F2O — CID 139863077
7-(4-but-2-enoxyphenyl)-1,2-difluoro-3-pentylnaphthalene (PubChem CID 139863077) has the molecular formula C25H26F2O and a molecular weight of 380.48 g/mol. Its IUPAC name is 7-(4-but-2-enoxyphenyl)-1,2-difluoro-3-pentylnaphthalene.
| Compound Name | 7-(4-but-2-enoxyphenyl)-1,2-difluoro-3-pentylnaphthalene |
|---|---|
| PubChem CID | 139863077 |
| Molecular Formula | C25H26F2O |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 7-(4-but-2-enoxyphenyl)-1,2-difluoro-3-pentylnaphthalene |
| SMILES | CC=CCOc1ccc(-c2ccc3cc(CCCCC)c(F)c(F)c3c2)cc1 |
| InChI | InChI=1S/C25H26F2O/c1-3-5-7-8-21-16-20-10-9-19(17-23(20)25(27)24(21)26)18-11-13-22(14-12-18)28-15-6-4-2/h4,6,9-14,16-17H,3,5,7-8,15H2,1-2H3 |
| InChIKey | XPOKWXCOOWYUMD-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|