C17H18F5N3O3S — CID 142503798
N-[2-[4-(pentafluoro-λ6-sulfanyl)phenoxy]ethyl]-2-(propanoylamino)pyridine-4-carboxamide (PubChem CID 142503798) has the molecular formula C17H18F5N3O3S and a molecular weight of 439.41 g/mol. Its IUPAC name is N-[2-[4-(pentafluoro-λ6-sulfanyl)phenoxy]ethyl]-2-(propanoylamino)pyridine-4-carboxamide.
| Compound Name | N-[2-[4-(pentafluoro-λ6-sulfanyl)phenoxy]ethyl]-2-(propanoylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 142503798 |
| Molecular Formula | C17H18F5N3O3S |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | N-[2-[4-(pentafluoro-λ6-sulfanyl)phenoxy]ethyl]-2-(propanoylamino)pyridine-4-carboxamide |
| SMILES | CCC(=O)Nc1cc(C(=O)NCCOc2ccc(S(F)(F)(F)(F)F)cc2)ccn1 |
| InChI | InChI=1S/C17H18F5N3O3S/c1-2-16(26)25-15-11-12(7-8-23-15)17(27)24-9-10-28-13-3-5-14(6-4-13)29(18,19,20,21)22/h3-8,11H,2,9-10H2,1H3,(H,24,27)(H,23,25,26) |
| InChIKey | SFGVTQYGEIRCCX-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|