C17H16F3N3O2S — CID 56966803
2-(propanoylamino)-N-[[4-(trifluoromethylsulfanyl)phenyl]methyl]pyridine-4-carboxamide (PubChem CID 56966803) has the molecular formula C17H16F3N3O2S and a molecular weight of 383.40 g/mol. Its IUPAC name is 2-(propanoylamino)-N-[[4-(trifluoromethylsulfanyl)phenyl]methyl]pyridine-4-carboxamide.
| Compound Name | 2-(propanoylamino)-N-[[4-(trifluoromethylsulfanyl)phenyl]methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 56966803 |
| Molecular Formula | C17H16F3N3O2S |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 2-(propanoylamino)-N-[[4-(trifluoromethylsulfanyl)phenyl]methyl]pyridine-4-carboxamide |
| SMILES | CCC(=O)Nc1cc(C(=O)NCc2ccc(SC(F)(F)F)cc2)ccn1 |
| InChI | InChI=1S/C17H16F3N3O2S/c1-2-15(24)23-14-9-12(7-8-21-14)16(25)22-10-11-3-5-13(6-4-11)26-17(18,19)20/h3-9H,2,10H2,1H3,(H,22,25)(H,21,23,24) |
| InChIKey | INPHZASUHUJHCW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |