C21H24F2N4O3 — CID 162566103
N-[[6-(2,2-difluoro-3-methylbut-3-enoxy)-5-methyl-3-pyridinyl]methyl]-2-(propanoylamino)pyridine-4-carboxamide (PubChem CID 162566103) has the molecular formula C21H24F2N4O3 and a molecular weight of 418.44 g/mol. Its IUPAC name is N-[[6-(2,2-difluoro-3-methylbut-3-enoxy)-5-methyl-3-pyridinyl]methyl]-2-(propanoylamino)pyridine-4-carboxamide.
| Compound Name | N-[[6-(2,2-difluoro-3-methylbut-3-enoxy)-5-methyl-3-pyridinyl]methyl]-2-(propanoylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 162566103 |
| Molecular Formula | C21H24F2N4O3 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | N-[[6-(2,2-difluoro-3-methylbut-3-enoxy)-5-methyl-3-pyridinyl]methyl]-2-(propanoylamino)pyridine-4-carboxamide |
| SMILES | C=C(C)C(F)(F)COc1ncc(CNC(=O)c2ccnc(NC(=O)CC)c2)cc1C |
| InChI | InChI=1S/C21H24F2N4O3/c1-5-18(28)27-17-9-16(6-7-24-17)19(29)25-10-15-8-14(4)20(26-11-15)30-12-21(22,23)13(2)3/h6-9,11H,2,5,10,12H2,1,3-4H3,(H,25,29)(H,24,27,28) |
| InChIKey | OLWYUJDLMOLBJH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|