C26H26F2N4O3 — CID 162566269
2-acetamido-N-[[6-(2,2-difluoro-3-methylbut-3-enoxy)-5-(2-methylphenyl)-3-pyridinyl]methyl]pyridine-4-carboxamide (PubChem CID 162566269) has the molecular formula C26H26F2N4O3 and a molecular weight of 480.52 g/mol. Its IUPAC name is 2-acetamido-N-[[6-(2,2-difluoro-3-methylbut-3-enoxy)-5-(2-methylphenyl)-3-pyridinyl]methyl]pyridine-4-carboxamide.
| Compound Name | 2-acetamido-N-[[6-(2,2-difluoro-3-methylbut-3-enoxy)-5-(2-methylphenyl)-3-pyridinyl]methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 162566269 |
| Molecular Formula | C26H26F2N4O3 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 2-acetamido-N-[[6-(2,2-difluoro-3-methylbut-3-enoxy)-5-(2-methylphenyl)-3-pyridinyl]methyl]pyridine-4-carboxamide |
| SMILES | C=C(C)C(F)(F)COc1ncc(CNC(=O)c2ccnc(NC(C)=O)c2)cc1-c1ccccc1C |
| InChI | InChI=1S/C26H26F2N4O3/c1-16(2)26(27,28)15-35-25-22(21-8-6-5-7-17(21)3)11-19(14-31-25)13-30-24(34)20-9-10-29-23(12-20)32-18(4)33/h5-12,14H,1,13,15H2,2-4H3,(H,30,34)(H,29,32,33) |
| InChIKey | IKEMZXIDKFVRGS-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|