C17H16F3N3O3 — CID 67509879
2-acetamido-N-[[3-methyl-5-(trifluoromethoxy)phenyl]methyl]pyridine-4-carboxamide (PubChem CID 67509879) has the molecular formula C17H16F3N3O3 and a molecular weight of 367.33 g/mol. Its IUPAC name is 2-acetamido-N-[[3-methyl-5-(trifluoromethoxy)phenyl]methyl]pyridine-4-carboxamide.
| Compound Name | 2-acetamido-N-[[3-methyl-5-(trifluoromethoxy)phenyl]methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 67509879 |
| Molecular Formula | C17H16F3N3O3 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 2-acetamido-N-[[3-methyl-5-(trifluoromethoxy)phenyl]methyl]pyridine-4-carboxamide |
| SMILES | CC(=O)Nc1cc(C(=O)NCc2cc(C)cc(OC(F)(F)F)c2)ccn1 |
| InChI | InChI=1S/C17H16F3N3O3/c1-10-5-12(7-14(6-10)26-17(18,19)20)9-22-16(25)13-3-4-21-15(8-13)23-11(2)24/h3-8H,9H2,1-2H3,(H,22,25)(H,21,23,24) |
| InChIKey | MVEXXXZUWQPQLW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |