C20H22F4N4O3 — CID 87426299
2-(2-methylpropanoylamino)-N-[[5-methyl-6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]methyl]pyridine-4-carboxamide (PubChem CID 87426299) has the molecular formula C20H22F4N4O3 and a molecular weight of 442.41 g/mol. Its IUPAC name is 2-(2-methylpropanoylamino)-N-[[5-methyl-6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]methyl]pyridine-4-carboxamide.
| Compound Name | 2-(2-methylpropanoylamino)-N-[[5-methyl-6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 87426299 |
| Molecular Formula | C20H22F4N4O3 |
| Molecular Weight | 442.41 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 2-(2-methylpropanoylamino)-N-[[5-methyl-6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]methyl]pyridine-4-carboxamide |
| SMILES | Cc1cc(CNC(=O)c2ccnc(NC(=O)C(C)C)c2)cnc1OCC(F)(F)C(F)F |
| InChI | InChI=1S/C20H22F4N4O3/c1-11(2)16(29)28-15-7-14(4-5-25-15)17(30)26-8-13-6-12(3)18(27-9-13)31-10-20(23,24)19(21)22/h4-7,9,11,19H,8,10H2,1-3H3,(H,26,30)(H,25,28,29) |
| InChIKey | UIEBWDYVTNFDCP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|