C17H13F2N3O3 — CID 41246588
2,6-difluoro-N-[2-[6-(furan-2-yl)pyridazin-3-yl]oxyethyl]benzamide (PubChem CID 41246588) has the molecular formula C17H13F2N3O3 and a molecular weight of 345.30 g/mol. Its IUPAC name is 2,6-difluoro-N-[2-[6-(furan-2-yl)pyridazin-3-yl]oxyethyl]benzamide.
| Compound Name | 2,6-difluoro-N-[2-[6-(furan-2-yl)pyridazin-3-yl]oxyethyl]benzamide |
|---|---|
| PubChem CID | 41246588 |
| Molecular Formula | C17H13F2N3O3 |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 2,6-difluoro-N-[2-[6-(furan-2-yl)pyridazin-3-yl]oxyethyl]benzamide |
| SMILES | O=C(NCCOc1ccc(-c2ccco2)nn1)c1c(F)cccc1F |
| InChI | InChI=1S/C17H13F2N3O3/c18-11-3-1-4-12(19)16(11)17(23)20-8-10-25-15-7-6-13(21-22-15)14-5-2-9-24-14/h1-7,9H,8,10H2,(H,20,23) |
| InChIKey | WHZRNZUXPYJDCP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|