C16H13F2N3O4S — CID 41246883
2,5-difluoro-N-[2-[6-(furan-2-yl)pyridazin-3-yl]oxyethyl]benzenesulfonamide (PubChem CID 41246883) has the molecular formula C16H13F2N3O4S and a molecular weight of 381.36 g/mol. Its IUPAC name is 2,5-difluoro-N-[2-[6-(furan-2-yl)pyridazin-3-yl]oxyethyl]benzenesulfonamide.
| Compound Name | 2,5-difluoro-N-[2-[6-(furan-2-yl)pyridazin-3-yl]oxyethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 41246883 |
| Molecular Formula | C16H13F2N3O4S |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 2,5-difluoro-N-[2-[6-(furan-2-yl)pyridazin-3-yl]oxyethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCOc1ccc(-c2ccco2)nn1)c1cc(F)ccc1F |
| InChI | InChI=1S/C16H13F2N3O4S/c17-11-3-4-12(18)15(10-11)26(22,23)19-7-9-25-16-6-5-13(20-21-16)14-2-1-8-24-14/h1-6,8,10,19H,7,9H2 |
| InChIKey | MTAQTDFWJMDABV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|