C19H21N3O5S — CID 41246930
N-[2-[6-(furan-2-yl)pyridazin-3-yl]oxyethyl]-4-methoxy-2,5-dimethylbenzenesulfonamide (PubChem CID 41246930) has the molecular formula C19H21N3O5S and a molecular weight of 403.46 g/mol. Its IUPAC name is N-[2-[6-(furan-2-yl)pyridazin-3-yl]oxyethyl]-4-methoxy-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-[2-[6-(furan-2-yl)pyridazin-3-yl]oxyethyl]-4-methoxy-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 41246930 |
| Molecular Formula | C19H21N3O5S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | N-[2-[6-(furan-2-yl)pyridazin-3-yl]oxyethyl]-4-methoxy-2,5-dimethylbenzenesulfonamide |
| SMILES | COc1cc(C)c(S(=O)(=O)NCCOc2ccc(-c3ccco3)nn2)cc1C |
| InChI | InChI=1S/C19H21N3O5S/c1-13-12-18(14(2)11-17(13)25-3)28(23,24)20-8-10-27-19-7-6-15(21-22-19)16-5-4-9-26-16/h4-7,9,11-12,20H,8,10H2,1-3H3 |
| InChIKey | DTEBMNFHBBNNFZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|