C16H14FN3O4S — CID 41246880
2-fluoro-N-[2-[6-(furan-2-yl)pyridazin-3-yl]oxyethyl]benzenesulfonamide (PubChem CID 41246880) has the molecular formula C16H14FN3O4S and a molecular weight of 363.37 g/mol. Its IUPAC name is 2-fluoro-N-[2-[6-(furan-2-yl)pyridazin-3-yl]oxyethyl]benzenesulfonamide.
| Compound Name | 2-fluoro-N-[2-[6-(furan-2-yl)pyridazin-3-yl]oxyethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 41246880 |
| Molecular Formula | C16H14FN3O4S |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 2-fluoro-N-[2-[6-(furan-2-yl)pyridazin-3-yl]oxyethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCOc1ccc(-c2ccco2)nn1)c1ccccc1F |
| InChI | InChI=1S/C16H14FN3O4S/c17-12-4-1-2-6-15(12)25(21,22)18-9-11-24-16-8-7-13(19-20-16)14-5-3-10-23-14/h1-8,10,18H,9,11H2 |
| InChIKey | AJQOTXTYDLJJPZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|