C20H21N3O3 — CID 41246615
N-[2-[6-(furan-2-yl)pyridazin-3-yl]oxyethyl]-4-phenylbutanamide (PubChem CID 41246615) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-[2-[6-(furan-2-yl)pyridazin-3-yl]oxyethyl]-4-phenylbutanamide.
| Compound Name | N-[2-[6-(furan-2-yl)pyridazin-3-yl]oxyethyl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 41246615 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N-[2-[6-(furan-2-yl)pyridazin-3-yl]oxyethyl]-4-phenylbutanamide |
| SMILES | O=C(CCCc1ccccc1)NCCOc1ccc(-c2ccco2)nn1 |
| InChI | InChI=1S/C20H21N3O3/c24-19(10-4-8-16-6-2-1-3-7-16)21-13-15-26-20-12-11-17(22-23-20)18-9-5-14-25-18/h1-3,5-7,9,11-12,14H,4,8,10,13,15H2,(H,21,24) |
| InChIKey | FCCMVEQFPFUDOK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|