C18H21ClN2O4 — CID 112975628
1-[(2-chlorophenyl)methyl]-3-[2-(3,5-dimethoxyphenoxy)ethyl]urea (PubChem CID 112975628) has the molecular formula C18H21ClN2O4 and a molecular weight of 364.83 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-3-[2-(3,5-dimethoxyphenoxy)ethyl]urea.
| Compound Name | 1-[(2-chlorophenyl)methyl]-3-[2-(3,5-dimethoxyphenoxy)ethyl]urea |
|---|---|
| PubChem CID | 112975628 |
| Molecular Formula | C18H21ClN2O4 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-3-[2-(3,5-dimethoxyphenoxy)ethyl]urea |
| SMILES | COc1cc(OC)cc(OCCNC(=O)NCc2ccccc2Cl)c1 |
| InChI | InChI=1S/C18H21ClN2O4/c1-23-14-9-15(24-2)11-16(10-14)25-8-7-20-18(22)21-12-13-5-3-4-6-17(13)19/h3-6,9-11H,7-8,12H2,1-2H3,(H2,20,21,22) |
| InChIKey | SRBKBIVTLPHHPC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|