C17H25N7O2 — CID 111700393
methyl N-[4-[[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]carbamate (PubChem CID 111700393) has the molecular formula C17H25N7O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is methyl N-[4-[[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]carbamate.
| Compound Name | methyl N-[4-[[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 111700393 |
| Molecular Formula | C17H25N7O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | methyl N-[4-[[[N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]carbamate |
| SMILES | CCc1nncn1CCN/C(=N\C)NCc1ccc(NC(=O)OC)cc1 |
| InChI | InChI=1S/C17H25N7O2/c1-4-15-23-21-12-24(15)10-9-19-16(18-2)20-11-13-5-7-14(8-6-13)22-17(25)26-3/h5-8,12H,4,9-11H2,1-3H3,(H,22,25)(H2,18,19,20) |
| InChIKey | OGHZIQGBEUMHBS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 105.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|