C19H28N4O2 — CID 109408120
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-(3-hydroxy-2-phenylpropyl)-2-methylguanidine (PubChem CID 109408120) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-(3-hydroxy-2-phenylpropyl)-2-methylguanidine.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-(3-hydroxy-2-phenylpropyl)-2-methylguanidine |
|---|---|
| PubChem CID | 109408120 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-(3-hydroxy-2-phenylpropyl)-2-methylguanidine |
| SMILES | C/N=C(\NCc1ncc(C(C)(C)C)o1)NCC(CO)c1ccccc1 |
| InChI | InChI=1S/C19H28N4O2/c1-19(2,3)16-11-21-17(25-16)12-23-18(20-4)22-10-15(13-24)14-8-6-5-7-9-14/h5-9,11,15,24H,10,12-13H2,1-4H3,(H2,20,22,23) |
| InChIKey | DNYXAHMRRQXRIT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|