C20H31IN4O — CID 111792852
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-(4-phenylbutan-2-yl)guanidine;hydroiodide (PubChem CID 111792852) has the molecular formula C20H31IN4O and a molecular weight of 470.40 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-(4-phenylbutan-2-yl)guanidine;hydroiodide.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-(4-phenylbutan-2-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111792852 |
| Molecular Formula | C20H31IN4O |
| Molecular Weight | 470.40 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-(4-phenylbutan-2-yl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ncc(C(C)(C)C)o1)NC(C)CCc1ccccc1.I |
| InChI | InChI=1S/C20H30N4O.HI/c1-15(11-12-16-9-7-6-8-10-16)24-19(21-5)23-14-18-22-13-17(25-18)20(2,3)4;/h6-10,13,15H,11-12,14H2,1-5H3,(H2,21,23,24);1H |
| InChIKey | CFMWCHDBKWWUHR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|