C20H30FN5O — CID 111592497
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[2-(dimethylamino)-2-(4-fluorophenyl)ethyl]-2-methylguanidine (PubChem CID 111592497) has the molecular formula C20H30FN5O and a molecular weight of 375.49 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[2-(dimethylamino)-2-(4-fluorophenyl)ethyl]-2-methylguanidine.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[2-(dimethylamino)-2-(4-fluorophenyl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111592497 |
| Molecular Formula | C20H30FN5O |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[2-(dimethylamino)-2-(4-fluorophenyl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1ncc(C(C)(C)C)o1)NCC(c1ccc(F)cc1)N(C)C |
| InChI | InChI=1S/C20H30FN5O/c1-20(2,3)17-12-23-18(27-17)13-25-19(22-4)24-11-16(26(5)6)14-7-9-15(21)10-8-14/h7-10,12,16H,11,13H2,1-6H3,(H2,22,24,25) |
| InChIKey | WKYGWIHUFPCCHA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|