C20H31FIN5O — CID 111594809
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111594809) has the molecular formula C20H31FIN5O and a molecular weight of 503.40 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111594809 |
| Molecular Formula | C20H31FIN5O |
| Molecular Weight | 503.40 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[2-(dimethylamino)-2-(3-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ncc(C(C)(C)C)o1)NCC(c1cccc(F)c1)N(C)C.I |
| InChI | InChI=1S/C20H30FN5O.HI/c1-20(2,3)17-12-23-18(27-17)13-25-19(22-4)24-11-16(26(5)6)14-8-7-9-15(21)10-14;/h7-10,12,16H,11,13H2,1-6H3,(H2,22,24,25);1H |
| InChIKey | XYVIBZABHMRMGF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|