C24H38IN5O — CID 111592654
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[3-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide (PubChem CID 111592654) has the molecular formula C24H38IN5O and a molecular weight of 539.51 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[3-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[3-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111592654 |
| Molecular Formula | C24H38IN5O |
| Molecular Weight | 539.51 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[3-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(CN2CCC(C)CC2)c1)NCc1ncc(C(C)(C)C)o1.I |
| InChI | InChI=1S/C24H37N5O.HI/c1-18-9-11-29(12-10-18)17-20-8-6-7-19(13-20)14-27-23(25-5)28-16-22-26-15-21(30-22)24(2,3)4;/h6-8,13,15,18H,9-12,14,16-17H2,1-5H3,(H2,25,27,28);1H |
| InChIKey | MJOWGABKOLJDAD-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|