C22H34N6O2 — CID 111595698
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-methylguanidine (PubChem CID 111595698) has the molecular formula C22H34N6O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-methylguanidine.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111595698 |
| Molecular Formula | C22H34N6O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCc1ccc(N2CC(C)OC(C)C2)nc1)NCc1ncc(C(C)(C)C)o1 |
| InChI | InChI=1S/C22H34N6O2/c1-15-13-28(14-16(2)29-15)19-8-7-17(9-24-19)10-26-21(23-6)27-12-20-25-11-18(30-20)22(3,4)5/h7-9,11,15-16H,10,12-14H2,1-6H3,(H2,23,26,27) |
| InChIKey | VWUUENAUMBMPJP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 87.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|