C22H31ClIN5OS — CID 111372278
1-[2-(4-chlorophenyl)sulfanylethyl]-3-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111372278) has the molecular formula C22H31ClIN5OS and a molecular weight of 575.95 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfanylethyl]-3-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-3-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111372278 |
| Molecular Formula | C22H31ClIN5OS |
| Molecular Weight | 575.95 g/mol |
| Exact Mass | 575.10 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-3-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCSc1ccc(Cl)cc1)NCc1ccc(N2CC(C)OC(C)C2)nc1.I |
| InChI | InChI=1S/C22H30ClN5OS.HI/c1-16-14-28(15-17(2)29-16)21-9-4-18(12-26-21)13-27-22(24-3)25-10-11-30-20-7-5-19(23)6-8-20;/h4-9,12,16-17H,10-11,13-15H2,1-3H3,(H2,24,25,27);1H |
| InChIKey | QOLXDNKHMCQCGU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.95 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|