C24H34IN5OS — CID 111557812
1-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-methyl-3-[(1-phenylsulfanylcyclopropyl)methyl]guanidine;hydroiodide (PubChem CID 111557812) has the molecular formula C24H34IN5OS and a molecular weight of 567.54 g/mol. Its IUPAC name is 1-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-methyl-3-[(1-phenylsulfanylcyclopropyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-methyl-3-[(1-phenylsulfanylcyclopropyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111557812 |
| Molecular Formula | C24H34IN5OS |
| Molecular Weight | 567.54 g/mol |
| Exact Mass | 567.15 |
| IUPAC Name | 1-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-methyl-3-[(1-phenylsulfanylcyclopropyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(N2CC(C)OC(C)C2)nc1)NCC1(Sc2ccccc2)CC1.I |
| InChI | InChI=1S/C24H33N5OS.HI/c1-18-15-29(16-19(2)30-18)22-10-9-20(13-26-22)14-27-23(25-3)28-17-24(11-12-24)31-21-7-5-4-6-8-21;/h4-10,13,18-19H,11-12,14-17H2,1-3H3,(H2,25,27,28);1H |
| InChIKey | HLGQEDRWJQYCDP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|