C22H35N5O — CID 111208877
1-[2-(cyclohexen-1-yl)ethyl]-3-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-methylguanidine (PubChem CID 111208877) has the molecular formula C22H35N5O and a molecular weight of 385.56 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-3-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-methylguanidine.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111208877 |
| Molecular Formula | C22H35N5O |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.28 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-[[6-(2,6-dimethylmorpholin-4-yl)-3-pyridinyl]methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCC1=CCCCC1)NCc1ccc(N2CC(C)OC(C)C2)nc1 |
| InChI | InChI=1S/C22H35N5O/c1-17-15-27(16-18(2)28-17)21-10-9-20(13-25-21)14-26-22(23-3)24-12-11-19-7-5-4-6-8-19/h7,9-10,13,17-18H,4-6,8,11-12,14-16H2,1-3H3,(H2,23,24,26) |
| InChIKey | PLOHNAMZIKKJME-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|