C20H36N4O3S2 — CID 111717546
1-(3-ethoxy-4-methylpentyl)-2-methyl-3-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine (PubChem CID 111717546) has the molecular formula C20H36N4O3S2 and a molecular weight of 444.67 g/mol. Its IUPAC name is 1-(3-ethoxy-4-methylpentyl)-2-methyl-3-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine.
| Compound Name | 1-(3-ethoxy-4-methylpentyl)-2-methyl-3-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111717546 |
| Molecular Formula | C20H36N4O3S2 |
| Molecular Weight | 444.67 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 1-(3-ethoxy-4-methylpentyl)-2-methyl-3-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine |
| SMILES | CCOC(CCN/C(=N\C)NCc1ccc(S(=O)(=O)N2CCCCC2)s1)C(C)C |
| InChI | InChI=1S/C20H36N4O3S2/c1-5-27-18(16(2)3)11-12-22-20(21-4)23-15-17-9-10-19(28-17)29(25,26)24-13-7-6-8-14-24/h9-10,16,18H,5-8,11-15H2,1-4H3,(H2,21,22,23) |
| InChIKey | DBUCMDUHCZVKHG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.67 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|