C19H33IN4O2S2 — CID 109468961
1-[(1-ethylcyclobutyl)methyl]-2-methyl-3-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 109468961) has the molecular formula C19H33IN4O2S2 and a molecular weight of 540.54 g/mol. Its IUPAC name is 1-[(1-ethylcyclobutyl)methyl]-2-methyl-3-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(1-ethylcyclobutyl)methyl]-2-methyl-3-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109468961 |
| Molecular Formula | C19H33IN4O2S2 |
| Molecular Weight | 540.54 g/mol |
| Exact Mass | 540.11 |
| IUPAC Name | 1-[(1-ethylcyclobutyl)methyl]-2-methyl-3-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCC1(CN/C(=N\C)NCc2ccc(S(=O)(=O)N3CCCCC3)s2)CCC1.I |
| InChI | InChI=1S/C19H32N4O2S2.HI/c1-3-19(10-7-11-19)15-22-18(20-2)21-14-16-8-9-17(26-16)27(24,25)23-12-5-4-6-13-23;/h8-9H,3-7,10-15H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | PMJDVJYFXGDXBA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|