C18H31IN4O3S2 — CID 111256900
2-methyl-1-(4-methylcyclohexyl)-3-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111256900) has the molecular formula C18H31IN4O3S2 and a molecular weight of 542.51 g/mol. Its IUPAC name is 2-methyl-1-(4-methylcyclohexyl)-3-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(4-methylcyclohexyl)-3-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111256900 |
| Molecular Formula | C18H31IN4O3S2 |
| Molecular Weight | 542.51 g/mol |
| Exact Mass | 542.09 |
| IUPAC Name | 2-methyl-1-(4-methylcyclohexyl)-3-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(S(=O)(=O)N2CCOCC2)s1)NC1CCC(C)CC1.I |
| InChI | InChI=1S/C18H30N4O3S2.HI/c1-14-3-5-15(6-4-14)21-18(19-2)20-13-16-7-8-17(26-16)27(23,24)22-9-11-25-12-10-22;/h7-8,14-15H,3-6,9-13H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | LJKIROVIEXVIPU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.51 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|