C17H24BrNO4S2 — CID 166793999
methyl 1-(5-bromothiophen-2-yl)sulfonyl-5-cyclohexylpiperidine-3-carboxylate (PubChem CID 166793999) has the molecular formula C17H24BrNO4S2 and a molecular weight of 450.42 g/mol. Its IUPAC name is methyl 1-(5-bromothiophen-2-yl)sulfonyl-5-cyclohexylpiperidine-3-carboxylate.
| Compound Name | methyl 1-(5-bromothiophen-2-yl)sulfonyl-5-cyclohexylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 166793999 |
| Molecular Formula | C17H24BrNO4S2 |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 449.03 |
| IUPAC Name | methyl 1-(5-bromothiophen-2-yl)sulfonyl-5-cyclohexylpiperidine-3-carboxylate |
| SMILES | COC(=O)C1CC(C2CCCCC2)CN(S(=O)(=O)c2ccc(Br)s2)C1 |
| InChI | InChI=1S/C17H24BrNO4S2/c1-23-17(20)14-9-13(12-5-3-2-4-6-12)10-19(11-14)25(21,22)16-8-7-15(18)24-16/h7-8,12-14H,2-6,9-11H2,1H3 |
| InChIKey | CLMPUYXDYZESME-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |