C18H24FNO3S — CID 90593824
1-(3-cyclohexylsulfonylazetidin-1-yl)-3-(2-fluorophenyl)propan-1-one (PubChem CID 90593824) has the molecular formula C18H24FNO3S and a molecular weight of 353.46 g/mol. Its IUPAC name is 1-(3-cyclohexylsulfonylazetidin-1-yl)-3-(2-fluorophenyl)propan-1-one.
| Compound Name | 1-(3-cyclohexylsulfonylazetidin-1-yl)-3-(2-fluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 90593824 |
| Molecular Formula | C18H24FNO3S |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 1-(3-cyclohexylsulfonylazetidin-1-yl)-3-(2-fluorophenyl)propan-1-one |
| SMILES | O=C(CCc1ccccc1F)N1CC(S(=O)(=O)C2CCCCC2)C1 |
| InChI | InChI=1S/C18H24FNO3S/c19-17-9-5-4-6-14(17)10-11-18(21)20-12-16(13-20)24(22,23)15-7-2-1-3-8-15/h4-6,9,15-16H,1-3,7-8,10-13H2 |
| InChIKey | OQTAISUICZFYEF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |