C18H26FNO3S — CID 126852221
3-(2-fluorophenyl)-1-[3-(2-methylpropylsulfonyl)piperidin-1-yl]propan-1-one (PubChem CID 126852221) has the molecular formula C18H26FNO3S and a molecular weight of 355.48 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-1-[3-(2-methylpropylsulfonyl)piperidin-1-yl]propan-1-one.
| Compound Name | 3-(2-fluorophenyl)-1-[3-(2-methylpropylsulfonyl)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 126852221 |
| Molecular Formula | C18H26FNO3S |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 3-(2-fluorophenyl)-1-[3-(2-methylpropylsulfonyl)piperidin-1-yl]propan-1-one |
| SMILES | CC(C)CS(=O)(=O)C1CCCN(C(=O)CCc2ccccc2F)C1 |
| InChI | InChI=1S/C18H26FNO3S/c1-14(2)13-24(22,23)16-7-5-11-20(12-16)18(21)10-9-15-6-3-4-8-17(15)19/h3-4,6,8,14,16H,5,7,9-13H2,1-2H3 |
| InChIKey | DMIJJPCPQMFQIJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |