C16H20ClNO3S2 — CID 71809508
1-[3-(4-chlorophenyl)sulfonylazetidin-1-yl]-2-cyclopentylsulfanylethanone (PubChem CID 71809508) has the molecular formula C16H20ClNO3S2 and a molecular weight of 373.93 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)sulfonylazetidin-1-yl]-2-cyclopentylsulfanylethanone.
| Compound Name | 1-[3-(4-chlorophenyl)sulfonylazetidin-1-yl]-2-cyclopentylsulfanylethanone |
|---|---|
| PubChem CID | 71809508 |
| Molecular Formula | C16H20ClNO3S2 |
| Molecular Weight | 373.93 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 1-[3-(4-chlorophenyl)sulfonylazetidin-1-yl]-2-cyclopentylsulfanylethanone |
| SMILES | O=C(CSC1CCCC1)N1CC(S(=O)(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C16H20ClNO3S2/c17-12-5-7-14(8-6-12)23(20,21)15-9-18(10-15)16(19)11-22-13-3-1-2-4-13/h5-8,13,15H,1-4,9-11H2 |
| InChIKey | PMQACXHOXAOPGO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.93 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |