C19H20ClNO5S2 — CID 90594954
1-[3-(4-chlorophenyl)sulfonylazetidin-1-yl]-3-(4-methylsulfonylphenyl)propan-1-one (PubChem CID 90594954) has the molecular formula C19H20ClNO5S2 and a molecular weight of 441.96 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)sulfonylazetidin-1-yl]-3-(4-methylsulfonylphenyl)propan-1-one.
| Compound Name | 1-[3-(4-chlorophenyl)sulfonylazetidin-1-yl]-3-(4-methylsulfonylphenyl)propan-1-one |
|---|---|
| PubChem CID | 90594954 |
| Molecular Formula | C19H20ClNO5S2 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.05 |
| IUPAC Name | 1-[3-(4-chlorophenyl)sulfonylazetidin-1-yl]-3-(4-methylsulfonylphenyl)propan-1-one |
| SMILES | CS(=O)(=O)c1ccc(CCC(=O)N2CC(S(=O)(=O)c3ccc(Cl)cc3)C2)cc1 |
| InChI | InChI=1S/C19H20ClNO5S2/c1-27(23,24)16-7-2-14(3-8-16)4-11-19(22)21-12-18(13-21)28(25,26)17-9-5-15(20)6-10-17/h2-3,5-10,18H,4,11-13H2,1H3 |
| InChIKey | AEQSRMQHEFDUDF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |