C25H24ClNO4S — CID 90594935
1-[3-(4-chlorophenyl)sulfonylazetidin-1-yl]-3-(3-phenylmethoxyphenyl)propan-1-one (PubChem CID 90594935) has the molecular formula C25H24ClNO4S and a molecular weight of 469.99 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)sulfonylazetidin-1-yl]-3-(3-phenylmethoxyphenyl)propan-1-one.
| Compound Name | 1-[3-(4-chlorophenyl)sulfonylazetidin-1-yl]-3-(3-phenylmethoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 90594935 |
| Molecular Formula | C25H24ClNO4S |
| Molecular Weight | 469.99 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | 1-[3-(4-chlorophenyl)sulfonylazetidin-1-yl]-3-(3-phenylmethoxyphenyl)propan-1-one |
| SMILES | O=C(CCc1cccc(OCc2ccccc2)c1)N1CC(S(=O)(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C25H24ClNO4S/c26-21-10-12-23(13-11-21)32(29,30)24-16-27(17-24)25(28)14-9-19-7-4-8-22(15-19)31-18-20-5-2-1-3-6-20/h1-8,10-13,15,24H,9,14,16-18H2 |
| InChIKey | LZURMTRTOANVSU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.99 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |