C25H37N3O5S — CID 11733699
prop-2-enyl (2S)-3-methyl-2-[[(2S)-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanethioyl]amino]-3-phenylpropanoyl]amino]butanoate (PubChem CID 11733699) has the molecular formula C25H37N3O5S and a molecular weight of 491.65 g/mol. Its IUPAC name is prop-2-enyl (2S)-3-methyl-2-[[(2S)-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanethioyl]amino]-3-phenylpropanoyl]amino]butanoate.
| Compound Name | prop-2-enyl (2S)-3-methyl-2-[[(2S)-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanethioyl]amino]-3-phenylpropanoyl]amino]butanoate |
|---|---|
| PubChem CID | 11733699 |
| Molecular Formula | C25H37N3O5S |
| Molecular Weight | 491.65 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | prop-2-enyl (2S)-3-methyl-2-[[(2S)-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanethioyl]amino]-3-phenylpropanoyl]amino]butanoate |
| SMILES | C=CCOC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=S)[C@@H](C)NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C25H37N3O5S/c1-8-14-32-23(30)20(16(2)3)28-21(29)19(15-18-12-10-9-11-13-18)27-22(34)17(4)26-24(31)33-25(5,6)7/h8-13,16-17,19-20H,1,14-15H2,2-7H3,(H,26,31)(H,27,34)(H,28,29)/t17-,19+,20+/m1/s1 |
| InChIKey | BVPKRKMIWSXBEZ-HOJAQTOUSA-N |
| XLogP | 3.30 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.65 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|