C13H20NO5- — CID 59457034
N-[5-[(2-methylpropan-2-yl)oxy]-1,5-dioxopentan-2-yl]-1-prop-2-enoxymethanimidate (PubChem CID 59457034) has the molecular formula C13H20NO5- and a molecular weight of 270.31 g/mol. Its IUPAC name is N-[5-[(2-methylpropan-2-yl)oxy]-1,5-dioxopentan-2-yl]-1-prop-2-enoxymethanimidate.
| Compound Name | N-[5-[(2-methylpropan-2-yl)oxy]-1,5-dioxopentan-2-yl]-1-prop-2-enoxymethanimidate |
|---|---|
| PubChem CID | 59457034 |
| Molecular Formula | C13H20NO5- |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | N-[5-[(2-methylpropan-2-yl)oxy]-1,5-dioxopentan-2-yl]-1-prop-2-enoxymethanimidate |
| SMILES | C=CCO/C([O-])=N/C(C=O)CCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H21NO5/c1-5-8-18-12(17)14-10(9-15)6-7-11(16)19-13(2,3)4/h5,9-10H,1,6-8H2,2-4H3,(H,14,17)/p-1 |
| InChIKey | HTEOBCLFPYKQDE-UHFFFAOYSA-M |
| XLogP | 0.59 |
| TPSA | 88.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|