C14H25NO5 — CID 175290344
2-[tert-butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-oxopentanoic acid (PubChem CID 175290344) has the molecular formula C14H25NO5 and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-[tert-butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-oxopentanoic acid.
| Compound Name | 2-[tert-butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 175290344 |
| Molecular Formula | C14H25NO5 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 2-[tert-butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-oxopentanoic acid |
| SMILES | CC(C)(C)OC(=O)N(C(CCC=O)C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C14H25NO5/c1-13(2,3)15(12(19)20-14(4,5)6)10(11(17)18)8-7-9-16/h9-10H,7-8H2,1-6H3,(H,17,18) |
| InChIKey | HCZHNCXWXSIVLI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|