C15H25NO8 — CID 169193825
dimethyl (2R,4S)-2-acetyloxy-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanedioate (PubChem CID 169193825) has the molecular formula C15H25NO8 and a molecular weight of 347.36 g/mol. Its IUPAC name is dimethyl (2R,4S)-2-acetyloxy-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanedioate.
| Compound Name | dimethyl (2R,4S)-2-acetyloxy-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanedioate |
|---|---|
| PubChem CID | 169193825 |
| Molecular Formula | C15H25NO8 |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | dimethyl (2R,4S)-2-acetyloxy-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanedioate |
| SMILES | COC(=O)[C@@H](C[C@@H](C(=O)OC)N(C)C(=O)OC(C)(C)C)OC(C)=O |
| InChI | InChI=1S/C15H25NO8/c1-9(17)23-11(13(19)22-7)8-10(12(18)21-6)16(5)14(20)24-15(2,3)4/h10-11H,8H2,1-7H3/t10-,11+/m0/s1 |
| InChIKey | QGXUBMMGRUYHBK-WDEREUQCSA-N |
| XLogP | 0.89 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|