C17H29NO7 — CID 57327500
methyl (2S,3S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-methyl-5-oxopentanoate (PubChem CID 57327500) has the molecular formula C17H29NO7 and a molecular weight of 359.42 g/mol. Its IUPAC name is methyl (2S,3S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-methyl-5-oxopentanoate.
| Compound Name | methyl (2S,3S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-methyl-5-oxopentanoate |
|---|---|
| PubChem CID | 57327500 |
| Molecular Formula | C17H29NO7 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | methyl (2S,3S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-methyl-5-oxopentanoate |
| SMILES | COC(=O)[C@H]([C@@H](C)CC=O)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H29NO7/c1-11(9-10-19)12(13(20)23-8)18(14(21)24-16(2,3)4)15(22)25-17(5,6)7/h10-12H,9H2,1-8H3/t11-,12-/m0/s1 |
| InChIKey | SZXXVVJQOOTHIX-RYUDHWBXSA-N |
| XLogP | 2.93 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|