C20H33NO7 — CID 56833986
methyl (2S,3R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[(2S)-but-3-en-2-yl]oxypent-4-enoate (PubChem CID 56833986) has the molecular formula C20H33NO7 and a molecular weight of 399.48 g/mol. Its IUPAC name is methyl (2S,3R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[(2S)-but-3-en-2-yl]oxypent-4-enoate.
| Compound Name | methyl (2S,3R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[(2S)-but-3-en-2-yl]oxypent-4-enoate |
|---|---|
| PubChem CID | 56833986 |
| Molecular Formula | C20H33NO7 |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | methyl (2S,3R)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-[(2S)-but-3-en-2-yl]oxypent-4-enoate |
| SMILES | C=C[C@H](C)O[C@H](C=C)[C@@H](C(=O)OC)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H33NO7/c1-11-13(3)26-14(12-2)15(16(22)25-10)21(17(23)27-19(4,5)6)18(24)28-20(7,8)9/h11-15H,1-2H2,3-10H3/t13-,14+,15-/m0/s1 |
| InChIKey | WQQUBROTADFTOR-ZNMIVQPWSA-N |
| XLogP | 3.85 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|