C22H32N2O7 — CID 59411479
[1-cyclohexyl-3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propan-2-yl] (4-nitrophenyl) carbonate (PubChem CID 59411479) has the molecular formula C22H32N2O7 and a molecular weight of 436.51 g/mol. Its IUPAC name is [1-cyclohexyl-3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propan-2-yl] (4-nitrophenyl) carbonate.
| Compound Name | [1-cyclohexyl-3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propan-2-yl] (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 59411479 |
| Molecular Formula | C22H32N2O7 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | [1-cyclohexyl-3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propan-2-yl] (4-nitrophenyl) carbonate |
| SMILES | CN(CC(CC1CCCCC1)OC(=O)Oc1ccc([N+](=O)[O-])cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H32N2O7/c1-22(2,3)31-20(25)23(4)15-19(14-16-8-6-5-7-9-16)30-21(26)29-18-12-10-17(11-13-18)24(27)28/h10-13,16,19H,5-9,14-15H2,1-4H3 |
| InChIKey | VHDGFOLPAXPMPZ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|